C10H15ClF3N5O — CID 14822079
6-chloro-4-N-(3-methoxypropyl)-2-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 14822079) has the molecular formula C10H15ClF3N5O and a molecular weight of 313.71 g/mol. Its IUPAC name is 6-chloro-4-N-(3-methoxypropyl)-2-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(3-methoxypropyl)-2-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 14822079 |
| Molecular Formula | C10H15ClF3N5O |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 6-chloro-4-N-(3-methoxypropyl)-2-N-(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | COCCCNc1nc(Cl)nc(NC(C)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H15ClF3N5O/c1-6(10(12,13)14)16-9-18-7(11)17-8(19-9)15-4-3-5-20-2/h6H,3-5H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | JDQHQINHMUKJSD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|