C12H17ClF5N5 — CID 163460730
6-chloro-4-N-[4-fluoro-2-(2-fluoroethyl)butyl]-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 163460730) has the molecular formula C12H17ClF5N5 and a molecular weight of 361.75 g/mol. Its IUPAC name is 6-chloro-4-N-[4-fluoro-2-(2-fluoroethyl)butyl]-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[4-fluoro-2-(2-fluoroethyl)butyl]-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 163460730 |
| Molecular Formula | C12H17ClF5N5 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 6-chloro-4-N-[4-fluoro-2-(2-fluoroethyl)butyl]-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@@H](Nc1nc(Cl)nc(NCC(CCF)CCF)n1)C(F)(F)F |
| InChI | InChI=1S/C12H17ClF5N5/c1-7(12(16,17)18)20-11-22-9(13)21-10(23-11)19-6-8(2-4-14)3-5-15/h7-8H,2-6H2,1H3,(H2,19,20,21,22,23)/t7-/m1/s1 |
| InChIKey | BOHYPVOTGWSAKV-SSDOTTSWSA-N |
| XLogP | 3.63 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |