C8H13ClN4 — CID 118932882
4-chloro-6-ethyl-N-propyl-1,3,5-triazin-2-amine (PubChem CID 118932882) has the molecular formula C8H13ClN4 and a molecular weight of 200.67 g/mol. Its IUPAC name is 4-chloro-6-ethyl-N-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-ethyl-N-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118932882 |
| Molecular Formula | C8H13ClN4 |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 4-chloro-6-ethyl-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCNc1nc(Cl)nc(CC)n1 |
| InChI | InChI=1S/C8H13ClN4/c1-3-5-10-8-12-6(4-2)11-7(9)13-8/h3-5H2,1-2H3,(H,10,11,12,13) |
| InChIKey | ATGZTPQRUMIZMO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |