C16H22ClN3 — CID 4667810
N-(2-chloroquinolin-5-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 4667810) has the molecular formula C16H22ClN3 and a molecular weight of 291.83 g/mol. Its IUPAC name is N-(2-chloroquinolin-5-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(2-chloroquinolin-5-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4667810 |
| Molecular Formula | C16H22ClN3 |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-(2-chloroquinolin-5-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1cccc2nc(Cl)ccc12 |
| InChI | InChI=1S/C16H22ClN3/c1-3-20(4-2)12-6-11-18-14-7-5-8-15-13(14)9-10-16(17)19-15/h5,7-10,18H,3-4,6,11-12H2,1-2H3 |
| InChIKey | UELOYEJQZHOYFU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|