C17H25ClN4O2 — CID 142582601
tert-butyl 4-[[(6-chloropyridazin-3-yl)amino]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 142582601) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is tert-butyl 4-[[(6-chloropyridazin-3-yl)amino]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 4-[[(6-chloropyridazin-3-yl)amino]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 142582601 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | tert-butyl 4-[[(6-chloropyridazin-3-yl)amino]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(CNc3ccc(Cl)nn3)C2C1 |
| InChI | InChI=1S/C17H25ClN4O2/c1-17(2,3)24-16(23)22-9-12-5-4-11(13(12)10-22)8-19-15-7-6-14(18)20-21-15/h6-7,11-13H,4-5,8-10H2,1-3H3,(H,19,21) |
| InChIKey | BOBRWRWLJKBHCN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |