C20H25Cl2NO3 — CID 158684764
tert-butyl 4-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 158684764) has the molecular formula C20H25Cl2NO3 and a molecular weight of 398.33 g/mol. Its IUPAC name is tert-butyl 4-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 4-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 158684764 |
| Molecular Formula | C20H25Cl2NO3 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | tert-butyl 4-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(CC(=O)c3ccc(Cl)cc3Cl)C2C1 |
| InChI | InChI=1S/C20H25Cl2NO3/c1-20(2,3)26-19(25)23-10-13-5-4-12(16(13)11-23)8-18(24)15-7-6-14(21)9-17(15)22/h6-7,9,12-13,16H,4-5,8,10-11H2,1-3H3 |
| InChIKey | JTYRFWVMXJBWTF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |