C19H27NO3 — CID 149000608
tert-butyl (3aR,4R,5S)-5-hydroxy-4-phenyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate (PubChem CID 149000608) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl (3aR,4R,5S)-5-hydroxy-4-phenyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl (3aR,4R,5S)-5-hydroxy-4-phenyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 149000608 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | tert-butyl (3aR,4R,5S)-5-hydroxy-4-phenyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC[C@H](O)[C@@H](c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C19H27NO3/c1-19(2,3)23-18(22)20-11-14-9-10-16(21)17(15(14)12-20)13-7-5-4-6-8-13/h4-8,14-17,21H,9-12H2,1-3H3/t14?,15-,16+,17+/m1/s1 |
| InChIKey | PZOQFGMQFRLXLM-HIGTXEFZSA-N |
| XLogP | 3.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |