C23H34N6O2 — CID 150207734
tert-butyl 4-[2-[[6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 150207734) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is tert-butyl 4-[2-[[6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 4-[2-[[6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 150207734 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | tert-butyl 4-[2-[[6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-yl]amino]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | Cc1cnn(C)c1-c1ccc(NCCC2CCC3CN(C(=O)OC(C)(C)C)CC23)nn1 |
| InChI | InChI=1S/C23H34N6O2/c1-15-12-25-28(5)21(15)19-8-9-20(27-26-19)24-11-10-16-6-7-17-13-29(14-18(16)17)22(30)31-23(2,3)4/h8-9,12,16-18H,6-7,10-11,13-14H2,1-5H3,(H,24,27) |
| InChIKey | FQVFDEGFPAXULQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |