C14H20N4O3 — CID 177169278
tert-butyl (2S,6R)-10-methyl-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-4-carboxylate (PubChem CID 177169278) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is tert-butyl (2S,6R)-10-methyl-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-4-carboxylate.
| Compound Name | tert-butyl (2S,6R)-10-methyl-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-4-carboxylate |
|---|---|
| PubChem CID | 177169278 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | tert-butyl (2S,6R)-10-methyl-8-oxo-1,4,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-4-carboxylate |
| SMILES | Cc1cnn2c1C(=O)N[C@@H]1CN(C(=O)OC(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C14H20N4O3/c1-8-5-15-18-10-7-17(13(20)21-14(2,3)4)6-9(10)16-12(19)11(8)18/h5,9-10H,6-7H2,1-4H3,(H,16,19)/t9-,10+/m1/s1 |
| InChIKey | IWSNQXZAIQRHBJ-ZJUUUORDSA-N |
| XLogP | 1.10 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |