C14H25N3O2 — CID 144996243
tert-butyl 3-(5-methylpyrazol-1-yl)azetidine-1-carboxylate;ethane (PubChem CID 144996243) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl 3-(5-methylpyrazol-1-yl)azetidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-(5-methylpyrazol-1-yl)azetidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 144996243 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | tert-butyl 3-(5-methylpyrazol-1-yl)azetidine-1-carboxylate;ethane |
| SMILES | CC.Cc1ccnn1C1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H19N3O2.C2H6/c1-9-5-6-13-15(9)10-7-14(8-10)11(16)17-12(2,3)4;1-2/h5-6,10H,7-8H2,1-4H3;1-2H3 |
| InChIKey | QZFPVKCNDXKQLD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |