C17H31N3O2 — CID 144669766
tert-butyl 3-(5-methyl-3-propan-2-ylpyrazol-1-yl)azetidine-1-carboxylate;ethane (PubChem CID 144669766) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is tert-butyl 3-(5-methyl-3-propan-2-ylpyrazol-1-yl)azetidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-(5-methyl-3-propan-2-ylpyrazol-1-yl)azetidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 144669766 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | tert-butyl 3-(5-methyl-3-propan-2-ylpyrazol-1-yl)azetidine-1-carboxylate;ethane |
| SMILES | CC.Cc1cc(C(C)C)nn1C1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H25N3O2.C2H6/c1-10(2)13-7-11(3)18(16-13)12-8-17(9-12)14(19)20-15(4,5)6;1-2/h7,10,12H,8-9H2,1-6H3;1-2H3 |
| InChIKey | OJEZHUSUWKQFGD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |