C10H19N3O2 — CID 169078814
tert-butyl 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrazole-5-carboxylate (PubChem CID 169078814) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is tert-butyl 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrazole-5-carboxylate.
| Compound Name | tert-butyl 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 169078814 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | tert-butyl 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CNNC2C1 |
| InChI | InChI=1S/C10H19N3O2/c1-10(2,3)15-9(14)13-5-7-4-11-12-8(7)6-13/h7-8,11-12H,4-6H2,1-3H3 |
| InChIKey | HIXSMDNXMMCNCE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |