C24H36N6O — CID 138578699
6-(1,4-dimethylpyrazol-5-yl)-N-[2-[2-(oxan-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethyl]pyridazin-3-amine (PubChem CID 138578699) has the molecular formula C24H36N6O and a molecular weight of 424.59 g/mol. Its IUPAC name is 6-(1,4-dimethylpyrazol-5-yl)-N-[2-[2-(oxan-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethyl]pyridazin-3-amine.
| Compound Name | 6-(1,4-dimethylpyrazol-5-yl)-N-[2-[2-(oxan-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 138578699 |
| Molecular Formula | C24H36N6O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 6-(1,4-dimethylpyrazol-5-yl)-N-[2-[2-(oxan-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]ethyl]pyridazin-3-amine |
| SMILES | Cc1cnn(C)c1-c1ccc(NCCC2CC3CN(CC4CCCOC4)CC3C2)nn1 |
| InChI | InChI=1S/C24H36N6O/c1-17-12-26-29(2)24(17)22-5-6-23(28-27-22)25-8-7-18-10-20-14-30(15-21(20)11-18)13-19-4-3-9-31-16-19/h5-6,12,18-21H,3-4,7-11,13-16H2,1-2H3,(H,25,28) |
| InChIKey | HRJVMONLCPBNCY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |