C24H38N6 — CID 138578262
N-[[(3aS,6aR)-2-(2,3,3-trimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]-6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-amine (PubChem CID 138578262) has the molecular formula C24H38N6 and a molecular weight of 410.61 g/mol. Its IUPAC name is N-[[(3aS,6aR)-2-(2,3,3-trimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]-6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-amine.
| Compound Name | N-[[(3aS,6aR)-2-(2,3,3-trimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]-6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 138578262 |
| Molecular Formula | C24H38N6 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | N-[[(3aS,6aR)-2-(2,3,3-trimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]-6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-amine |
| SMILES | Cc1cnn(C)c1-c1ccc(NCC2C[C@@H]3CN(CC(C)C(C)(C)C)C[C@@H]3C2)nn1 |
| InChI | InChI=1S/C24H38N6/c1-16-11-26-29(6)23(16)21-7-8-22(28-27-21)25-12-18-9-19-14-30(15-20(19)10-18)13-17(2)24(3,4)5/h7-8,11,17-20H,9-10,12-15H2,1-6H3,(H,25,28)/t17?,18?,19-,20+ |
| InChIKey | SBCZVQNAVJVAQJ-KHSMEXAKSA-N |
| XLogP | 4.24 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |