C24H28FN5O — CID 138578464
5-[[6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-yl]oxymethyl]-2-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 138578464) has the molecular formula C24H28FN5O and a molecular weight of 421.52 g/mol. Its IUPAC name is 5-[[6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-yl]oxymethyl]-2-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 5-[[6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-yl]oxymethyl]-2-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 138578464 |
| Molecular Formula | C24H28FN5O |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 5-[[6-(1,4-dimethylpyrazol-5-yl)pyridazin-3-yl]oxymethyl]-2-[(4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Cc1cnn(C)c1-c1ccc(OCC2CC3CN(Cc4ccc(F)cc4)CC3C2)nn1 |
| InChI | InChI=1S/C24H28FN5O/c1-16-11-26-29(2)24(16)22-7-8-23(28-27-22)31-15-18-9-19-13-30(14-20(19)10-18)12-17-3-5-21(25)6-4-17/h3-8,11,18-20H,9-10,12-15H2,1-2H3 |
| InChIKey | BRBMWMGDKSVSBS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |