C16H20FN3 — CID 163346092
2-ethyl-1-[[1-[(4-fluorophenyl)methyl]azetidin-3-yl]methyl]imidazole (PubChem CID 163346092) has the molecular formula C16H20FN3 and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-ethyl-1-[[1-[(4-fluorophenyl)methyl]azetidin-3-yl]methyl]imidazole.
| Compound Name | 2-ethyl-1-[[1-[(4-fluorophenyl)methyl]azetidin-3-yl]methyl]imidazole |
|---|---|
| PubChem CID | 163346092 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-ethyl-1-[[1-[(4-fluorophenyl)methyl]azetidin-3-yl]methyl]imidazole |
| SMILES | CCc1nccn1CC1CN(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H20FN3/c1-2-16-18-7-8-20(16)12-14-10-19(11-14)9-13-3-5-15(17)6-4-13/h3-8,14H,2,9-12H2,1H3 |
| InChIKey | ZDXJJROPBQTHTF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |