C26H35N5O — CID 142563551
(3aR,6aS)-2-(2-bicyclo[2.2.2]oct-5-enylmethyl)-5-[[6-(1,3-dimethylpyrazol-4-yl)pyridazin-3-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 142563551) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is (3aR,6aS)-2-(2-bicyclo[2.2.2]oct-5-enylmethyl)-5-[[6-(1,3-dimethylpyrazol-4-yl)pyridazin-3-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-2-(2-bicyclo[2.2.2]oct-5-enylmethyl)-5-[[6-(1,3-dimethylpyrazol-4-yl)pyridazin-3-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 142563551 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | (3aR,6aS)-2-(2-bicyclo[2.2.2]oct-5-enylmethyl)-5-[[6-(1,3-dimethylpyrazol-4-yl)pyridazin-3-yl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Cc1nn(C)cc1-c1ccc(OCC2C[C@@H]3CN(CC4CC5C=CC4CC5)C[C@@H]3C2)nn1 |
| InChI | InChI=1S/C26H35N5O/c1-17-24(15-30(2)29-17)25-7-8-26(28-27-25)32-16-19-10-22-13-31(14-23(22)11-19)12-21-9-18-3-5-20(21)6-4-18/h3,5,7-8,15,18-23H,4,6,9-14,16H2,1-2H3/t18?,19?,20?,21?,22-,23+ |
| InChIKey | WTHMOSMVEUSGGC-FLLLSTGNSA-N |
| XLogP | 4.12 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|