C25H33N5 — CID 165102295
(3aS,6aR)-2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-5-[[5-(1,3-dimethylpyrazol-4-yl)pyrazin-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 165102295) has the molecular formula C25H33N5 and a molecular weight of 403.57 g/mol. Its IUPAC name is (3aS,6aR)-2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-5-[[5-(1,3-dimethylpyrazol-4-yl)pyrazin-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-5-[[5-(1,3-dimethylpyrazol-4-yl)pyrazin-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 165102295 |
| Molecular Formula | C25H33N5 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | (3aS,6aR)-2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-5-[[5-(1,3-dimethylpyrazol-4-yl)pyrazin-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Cc1nn(C)cc1-c1cnc(CC2C[C@@H]3CN(CC4CC5C=CC4C5)C[C@@H]3C2)cn1 |
| InChI | InChI=1S/C25H33N5/c1-16-24(15-29(2)28-16)25-11-26-23(10-27-25)9-18-7-21-13-30(14-22(21)8-18)12-20-6-17-3-4-19(20)5-17/h3-4,10-11,15,17-22H,5-9,12-14H2,1-2H3/t17?,18?,19?,20?,21-,22+ |
| InChIKey | YNOYDGJJMJOXPL-JSTQWBQJSA-N |
| XLogP | 3.90 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|