C23H35N5 — CID 165095702
(3aS,6aR)-2-(3,3-dimethylbutyl)-5-[[5-(1,3-dimethylpyrazol-4-yl)pyrazin-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 165095702) has the molecular formula C23H35N5 and a molecular weight of 381.57 g/mol. Its IUPAC name is (3aS,6aR)-2-(3,3-dimethylbutyl)-5-[[5-(1,3-dimethylpyrazol-4-yl)pyrazin-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-2-(3,3-dimethylbutyl)-5-[[5-(1,3-dimethylpyrazol-4-yl)pyrazin-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 165095702 |
| Molecular Formula | C23H35N5 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | (3aS,6aR)-2-(3,3-dimethylbutyl)-5-[[5-(1,3-dimethylpyrazol-4-yl)pyrazin-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Cc1nn(C)cc1-c1cnc(CC2C[C@@H]3CN(CCC(C)(C)C)C[C@@H]3C2)cn1 |
| InChI | InChI=1S/C23H35N5/c1-16-21(15-27(5)26-16)22-12-24-20(11-25-22)10-17-8-18-13-28(14-19(18)9-17)7-6-23(2,3)4/h11-12,15,17-19H,6-10,13-14H2,1-5H3/t17?,18-,19+ |
| InChIKey | XLTVEIJQMLVYTF-YQQQUEKLSA-N |
| XLogP | 4.12 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |