C22H36N4O — CID 158286096
4-[6-[[(3aS,6aR)-2-(3,3-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]pyridazin-3-yl]morpholine (PubChem CID 158286096) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is 4-[6-[[(3aS,6aR)-2-(3,3-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]pyridazin-3-yl]morpholine.
| Compound Name | 4-[6-[[(3aS,6aR)-2-(3,3-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]pyridazin-3-yl]morpholine |
|---|---|
| PubChem CID | 158286096 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 4-[6-[[(3aS,6aR)-2-(3,3-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]pyridazin-3-yl]morpholine |
| SMILES | CC(C)(C)CCN1C[C@H]2CC(Cc3ccc(N4CCOCC4)nn3)C[C@H]2C1 |
| InChI | InChI=1S/C22H36N4O/c1-22(2,3)6-7-25-15-18-12-17(13-19(18)16-25)14-20-4-5-21(24-23-20)26-8-10-27-11-9-26/h4-5,17-19H,6-16H2,1-3H3/t17?,18-,19+ |
| InChIKey | GKULVVUAFUCEGP-YQQQUEKLSA-N |
| XLogP | 3.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |