C16H14BrN3O2 — CID 91959003
2-bromo-4-prop-2-enyl-N-(pyridin-3-ylmethyl)furo[3,2-b]pyrrole-5-carboxamide (PubChem CID 91959003) has the molecular formula C16H14BrN3O2 and a molecular weight of 360.21 g/mol. Its IUPAC name is 2-bromo-4-prop-2-enyl-N-(pyridin-3-ylmethyl)furo[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-bromo-4-prop-2-enyl-N-(pyridin-3-ylmethyl)furo[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 91959003 |
| Molecular Formula | C16H14BrN3O2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2-bromo-4-prop-2-enyl-N-(pyridin-3-ylmethyl)furo[3,2-b]pyrrole-5-carboxamide |
| SMILES | C=CCn1c(C(=O)NCc2cccnc2)cc2oc(Br)cc21 |
| InChI | InChI=1S/C16H14BrN3O2/c1-2-6-20-12-8-15(17)22-14(12)7-13(20)16(21)19-10-11-4-3-5-18-9-11/h2-5,7-9H,1,6,10H2,(H,19,21) |
| InChIKey | CVYRNKSYPSGRMA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|