C18H18N6O2 — CID 29097126
1-methyl-3-N,5-N-bis(pyridin-3-ylmethyl)pyrazole-3,5-dicarboxamide (PubChem CID 29097126) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 1-methyl-3-N,5-N-bis(pyridin-3-ylmethyl)pyrazole-3,5-dicarboxamide.
| Compound Name | 1-methyl-3-N,5-N-bis(pyridin-3-ylmethyl)pyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 29097126 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-methyl-3-N,5-N-bis(pyridin-3-ylmethyl)pyrazole-3,5-dicarboxamide |
| SMILES | Cn1nc(C(=O)NCc2cccnc2)cc1C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C18H18N6O2/c1-24-16(18(26)22-12-14-5-3-7-20-10-14)8-15(23-24)17(25)21-11-13-4-2-6-19-9-13/h2-10H,11-12H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | AOQBPUFDNNTYHQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |