C14H14BrN3O — CID 43641323
4-bromo-1-cyclopropyl-N-(pyridin-3-ylmethyl)pyrrole-2-carboxamide (PubChem CID 43641323) has the molecular formula C14H14BrN3O and a molecular weight of 320.19 g/mol. Its IUPAC name is 4-bromo-1-cyclopropyl-N-(pyridin-3-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-cyclopropyl-N-(pyridin-3-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43641323 |
| Molecular Formula | C14H14BrN3O |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 4-bromo-1-cyclopropyl-N-(pyridin-3-ylmethyl)pyrrole-2-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1cc(Br)cn1C1CC1 |
| InChI | InChI=1S/C14H14BrN3O/c15-11-6-13(18(9-11)12-3-4-12)14(19)17-8-10-2-1-5-16-7-10/h1-2,5-7,9,12H,3-4,8H2,(H,17,19) |
| InChIKey | DPPCTNVGGOZVQY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |