C18H21BrN4O2 — CID 91958920
2-bromo-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-prop-2-enylfuro[3,2-b]pyrrole-5-carboxamide (PubChem CID 91958920) has the molecular formula C18H21BrN4O2 and a molecular weight of 405.30 g/mol. Its IUPAC name is 2-bromo-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-prop-2-enylfuro[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-bromo-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-prop-2-enylfuro[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 91958920 |
| Molecular Formula | C18H21BrN4O2 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-bromo-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-prop-2-enylfuro[3,2-b]pyrrole-5-carboxamide |
| SMILES | C=CCn1c(C(=O)NCc2c(C)nn(CC)c2C)cc2oc(Br)cc21 |
| InChI | InChI=1S/C18H21BrN4O2/c1-5-7-22-14-9-17(19)25-16(14)8-15(22)18(24)20-10-13-11(3)21-23(6-2)12(13)4/h5,8-9H,1,6-7,10H2,2-4H3,(H,20,24) |
| InChIKey | KESVTTBRSMGDIG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|