C16H20BrN3O2 — CID 91958726
2-bromo-4-methyl-N-(1-prop-2-enylpiperidin-4-yl)furo[3,2-b]pyrrole-5-carboxamide (PubChem CID 91958726) has the molecular formula C16H20BrN3O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 2-bromo-4-methyl-N-(1-prop-2-enylpiperidin-4-yl)furo[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 2-bromo-4-methyl-N-(1-prop-2-enylpiperidin-4-yl)furo[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 91958726 |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-bromo-4-methyl-N-(1-prop-2-enylpiperidin-4-yl)furo[3,2-b]pyrrole-5-carboxamide |
| SMILES | C=CCN1CCC(NC(=O)c2cc3oc(Br)cc3n2C)CC1 |
| InChI | InChI=1S/C16H20BrN3O2/c1-3-6-20-7-4-11(5-8-20)18-16(21)13-9-14-12(19(13)2)10-15(17)22-14/h3,9-11H,1,4-8H2,2H3,(H,18,21) |
| InChIKey | PWTCPUXRDFCKTG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|