C18H23BrN2O4 — CID 91958157
2-bromo-4-(2-methoxyethoxy)-N-(1-methylpiperidin-4-yl)-1-benzofuran-6-carboxamide (PubChem CID 91958157) has the molecular formula C18H23BrN2O4 and a molecular weight of 411.30 g/mol. Its IUPAC name is 2-bromo-4-(2-methoxyethoxy)-N-(1-methylpiperidin-4-yl)-1-benzofuran-6-carboxamide.
| Compound Name | 2-bromo-4-(2-methoxyethoxy)-N-(1-methylpiperidin-4-yl)-1-benzofuran-6-carboxamide |
|---|---|
| PubChem CID | 91958157 |
| Molecular Formula | C18H23BrN2O4 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-bromo-4-(2-methoxyethoxy)-N-(1-methylpiperidin-4-yl)-1-benzofuran-6-carboxamide |
| SMILES | COCCOc1cc(C(=O)NC2CCN(C)CC2)cc2oc(Br)cc12 |
| InChI | InChI=1S/C18H23BrN2O4/c1-21-5-3-13(4-6-21)20-18(22)12-9-15(24-8-7-23-2)14-11-17(19)25-16(14)10-12/h9-11,13H,3-8H2,1-2H3,(H,20,22) |
| InChIKey | DSVSIGQPQFHLNH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|