C16H19BrN2O3 — CID 91958080
2-bromo-4-methoxy-N-(1-methylpiperidin-4-yl)-1-benzofuran-6-carboxamide (PubChem CID 91958080) has the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. Its IUPAC name is 2-bromo-4-methoxy-N-(1-methylpiperidin-4-yl)-1-benzofuran-6-carboxamide.
| Compound Name | 2-bromo-4-methoxy-N-(1-methylpiperidin-4-yl)-1-benzofuran-6-carboxamide |
|---|---|
| PubChem CID | 91958080 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-bromo-4-methoxy-N-(1-methylpiperidin-4-yl)-1-benzofuran-6-carboxamide |
| SMILES | COc1cc(C(=O)NC2CCN(C)CC2)cc2oc(Br)cc12 |
| InChI | InChI=1S/C16H19BrN2O3/c1-19-5-3-11(4-6-19)18-16(20)10-7-13(21-2)12-9-15(17)22-14(12)8-10/h7-9,11H,3-6H2,1-2H3,(H,18,20) |
| InChIKey | OPSQPUJLUJASOS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |