C24H26ClFN4O7 — CID 15988040
3-[1-[2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 15988040) has the molecular formula C24H26ClFN4O7 and a molecular weight of 536.94 g/mol. Its IUPAC name is 3-[1-[2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[1-[2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 15988040 |
| Molecular Formula | C24H26ClFN4O7 |
| Molecular Weight | 536.94 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 3-[1-[2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCn1c(=O)c2cc(OC)c(OC)cc2n(CC(=O)Nc2ccc(Cl)cc2F)c1=O |
| InChI | InChI=1S/C24H26ClFN4O7/c1-35-9-7-27-21(31)6-8-29-23(33)15-11-19(36-2)20(37-3)12-18(15)30(24(29)34)13-22(32)28-17-5-4-14(25)10-16(17)26/h4-5,10-12H,6-9,13H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | SNCDXFIAEKHNPR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.94 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|