C17H23N3O3 — CID 51696247
N-[(2R)-butan-2-yl]-2-(2,4-dioxo-3-propylquinazolin-1-yl)acetamide (PubChem CID 51696247) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-(2,4-dioxo-3-propylquinazolin-1-yl)acetamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-(2,4-dioxo-3-propylquinazolin-1-yl)acetamide |
|---|---|
| PubChem CID | 51696247 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-(2,4-dioxo-3-propylquinazolin-1-yl)acetamide |
| SMILES | CCCn1c(=O)c2ccccc2n(CC(=O)N[C@H](C)CC)c1=O |
| InChI | InChI=1S/C17H23N3O3/c1-4-10-19-16(22)13-8-6-7-9-14(13)20(17(19)23)11-15(21)18-12(3)5-2/h6-9,12H,4-5,10-11H2,1-3H3,(H,18,21)/t12-/m1/s1 |
| InChIKey | ILBGAIDAZPAHMZ-GFCCVEGCSA-N |
| XLogP | 1.49 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |