C26H31ClN4O4 — CID 50763028
5-[1-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(3-methylbutyl)pentanamide (PubChem CID 50763028) has the molecular formula C26H31ClN4O4 and a molecular weight of 499.01 g/mol. Its IUPAC name is 5-[1-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(3-methylbutyl)pentanamide.
| Compound Name | 5-[1-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(3-methylbutyl)pentanamide |
|---|---|
| PubChem CID | 50763028 |
| Molecular Formula | C26H31ClN4O4 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 5-[1-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(3-methylbutyl)pentanamide |
| SMILES | CC(C)CCNC(=O)CCCCn1c(=O)c2ccccc2n(CC(=O)Nc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C26H31ClN4O4/c1-18(2)14-15-28-23(32)9-5-6-16-30-25(34)21-7-3-4-8-22(21)31(26(30)35)17-24(33)29-20-12-10-19(27)11-13-20/h3-4,7-8,10-13,18H,5-6,9,14-17H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | UOZQWQYPHLTXRY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|