C27H34N4O4 — CID 27371259
5-[2,4-dioxo-1-[2-oxo-2-(3-phenylpropylamino)ethyl]quinazolin-3-yl]-N-propan-2-ylpentanamide (PubChem CID 27371259) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 5-[2,4-dioxo-1-[2-oxo-2-(3-phenylpropylamino)ethyl]quinazolin-3-yl]-N-propan-2-ylpentanamide.
| Compound Name | 5-[2,4-dioxo-1-[2-oxo-2-(3-phenylpropylamino)ethyl]quinazolin-3-yl]-N-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 27371259 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 5-[2,4-dioxo-1-[2-oxo-2-(3-phenylpropylamino)ethyl]quinazolin-3-yl]-N-propan-2-ylpentanamide |
| SMILES | CC(C)NC(=O)CCCCn1c(=O)c2ccccc2n(CC(=O)NCCCc2ccccc2)c1=O |
| InChI | InChI=1S/C27H34N4O4/c1-20(2)29-24(32)16-8-9-18-30-26(34)22-14-6-7-15-23(22)31(27(30)35)19-25(33)28-17-10-13-21-11-4-3-5-12-21/h3-7,11-12,14-15,20H,8-10,13,16-19H2,1-2H3,(H,28,33)(H,29,32) |
| InChIKey | JLACLKLGVLBPCP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|