C25H27N3O4 — CID 6619275
N-cyclopentyl-4-(2,4-dioxo-1-phenacylquinazolin-3-yl)butanamide (PubChem CID 6619275) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-cyclopentyl-4-(2,4-dioxo-1-phenacylquinazolin-3-yl)butanamide.
| Compound Name | N-cyclopentyl-4-(2,4-dioxo-1-phenacylquinazolin-3-yl)butanamide |
|---|---|
| PubChem CID | 6619275 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-cyclopentyl-4-(2,4-dioxo-1-phenacylquinazolin-3-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)c2ccccc2n(CC(=O)c2ccccc2)c1=O)NC1CCCC1 |
| InChI | InChI=1S/C25H27N3O4/c29-22(18-9-2-1-3-10-18)17-28-21-14-7-6-13-20(21)24(31)27(25(28)32)16-8-15-23(30)26-19-11-4-5-12-19/h1-3,6-7,9-10,13-14,19H,4-5,8,11-12,15-17H2,(H,26,30) |
| InChIKey | RMRQBVONPVUBCF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |