C26H19NO8 — CID 136679493
1-(3,4-dihydroxyphenyl)-3-[2-(3,4-dihydroxyphenyl)ethyl]-2,5-dihydroxybenzo[e]indole-7,8-dione (PubChem CID 136679493) has the molecular formula C26H19NO8 and a molecular weight of 473.44 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-3-[2-(3,4-dihydroxyphenyl)ethyl]-2,5-dihydroxybenzo[e]indole-7,8-dione.
| Compound Name | 1-(3,4-dihydroxyphenyl)-3-[2-(3,4-dihydroxyphenyl)ethyl]-2,5-dihydroxybenzo[e]indole-7,8-dione |
|---|---|
| PubChem CID | 136679493 |
| Molecular Formula | C26H19NO8 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-3-[2-(3,4-dihydroxyphenyl)ethyl]-2,5-dihydroxybenzo[e]indole-7,8-dione |
| SMILES | O=C1C=c2c(O)cc3c(c(-c4ccc(O)c(O)c4)c(O)n3CCc3ccc(O)c(O)c3)c2=CC1=O |
| InChI | InChI=1S/C26H19NO8/c28-17-3-1-12(7-20(17)31)5-6-27-16-11-19(30)14-9-22(33)23(34)10-15(14)25(16)24(26(27)35)13-2-4-18(29)21(32)8-13/h1-4,7-11,28-32,35H,5-6H2 |
| InChIKey | PSXHUEUPSHZNRS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|