C18H18N2O4 — CID 177406734
4-[3-[4-(3,4-dihydroxyphenyl)imidazol-1-yl]propyl]benzene-1,2-diol (PubChem CID 177406734) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-[3-[4-(3,4-dihydroxyphenyl)imidazol-1-yl]propyl]benzene-1,2-diol.
| Compound Name | 4-[3-[4-(3,4-dihydroxyphenyl)imidazol-1-yl]propyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 177406734 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-[3-[4-(3,4-dihydroxyphenyl)imidazol-1-yl]propyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CCCn2cnc(-c3ccc(O)c(O)c3)c2)cc1O |
| InChI | InChI=1S/C18H18N2O4/c21-15-5-3-12(8-17(15)23)2-1-7-20-10-14(19-11-20)13-4-6-16(22)18(24)9-13/h3-6,8-11,21-24H,1-2,7H2 |
| InChIKey | UPYIYMPDWJORMU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|