C15H16ClN3O5 — CID 3736130
1-(4-chlorophenyl)-5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 3736130) has the molecular formula C15H16ClN3O5 and a molecular weight of 353.76 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(4-chlorophenyl)-5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3736130 |
| Molecular Formula | C15H16ClN3O5 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CC(CO)(CO)/N=C/c1c(O)n(-c2ccc(Cl)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H16ClN3O5/c1-15(7-20,8-21)17-6-11-12(22)18-14(24)19(13(11)23)10-4-2-9(16)3-5-10/h2-6,20-21,23H,7-8H2,1H3,(H,18,22,24)/b17-6+ |
| InChIKey | VMMISDSHYHHYDH-UBKPWBPPSA-N |
| XLogP | 0.05 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|