C21H24ClN3O3 — CID 136719796
1-(4-chlorophenyl)-6-hydroxy-5-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]iminomethyl]pyrimidine-2,4-dione (PubChem CID 136719796) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-hydroxy-5-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-chlorophenyl)-6-hydroxy-5-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136719796 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 1-(4-chlorophenyl)-6-hydroxy-5-[[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]iminomethyl]pyrimidine-2,4-dione |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@@H](/N=C/c1c(O)n(-c3ccc(Cl)cc3)c(=O)[nH]c1=O)C2 |
| InChI | InChI=1S/C21H24ClN3O3/c1-20(2)12-8-9-21(20,3)16(10-12)23-11-15-17(26)24-19(28)25(18(15)27)14-6-4-13(22)5-7-14/h4-7,11-12,16,27H,8-10H2,1-3H3,(H,24,26,28)/b23-11+/t12-,16-,21-/m0/s1 |
| InChIKey | MUAZMTPBXKCVGT-NIOYEAJHSA-N |
| XLogP | 3.52 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|