C25H26N4O2S — CID 4555692
1-(3,4-dimethylphenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 4555692) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(3,4-dimethylphenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 4555692 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCC(Cc1c[nH]c2ccccc12)/N=C/c1c(O)n(-c2ccc(C)c(C)c2)c(=S)[nH]c1=O |
| InChI | InChI=1S/C25H26N4O2S/c1-4-18(12-17-13-27-22-8-6-5-7-20(17)22)26-14-21-23(30)28-25(32)29(24(21)31)19-10-9-15(2)16(3)11-19/h5-11,13-14,18,27,31H,4,12H2,1-3H3,(H,28,30,32)/b26-14+ |
| InChIKey | QAKRIONTPXPCQK-VULFUBBASA-N |
| XLogP | 5.14 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|