C20H22N4O3 — CID 135899979
6-hydroxy-5-[[(2R)-1-(1H-indol-3-yl)butan-2-yl]iminomethyl]-1-prop-2-enylpyrimidine-2,4-dione (PubChem CID 135899979) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 6-hydroxy-5-[[(2R)-1-(1H-indol-3-yl)butan-2-yl]iminomethyl]-1-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[[(2R)-1-(1H-indol-3-yl)butan-2-yl]iminomethyl]-1-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135899979 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 6-hydroxy-5-[[(2R)-1-(1H-indol-3-yl)butan-2-yl]iminomethyl]-1-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCn1c(O)c(/C=N/[C@H](CC)Cc2c[nH]c3ccccc23)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H22N4O3/c1-3-9-24-19(26)16(18(25)23-20(24)27)12-21-14(4-2)10-13-11-22-17-8-6-5-7-15(13)17/h3,5-8,11-12,14,22,26H,1,4,9-10H2,2H3,(H,23,25,27)/b21-12+/t14-/m1/s1 |
| InChIKey | QFUFWNSKKCFSAC-STCDJXRXSA-N |
| XLogP | 2.35 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|