C23H20N4O6 — CID 135937391
(2S)-2-[[6-hydroxy-1-(3-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 135937391) has the molecular formula C23H20N4O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is (2S)-2-[[6-hydroxy-1-(3-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[6-hydroxy-1-(3-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 135937391 |
| Molecular Formula | C23H20N4O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (2S)-2-[[6-hydroxy-1-(3-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | COc1cccc(-n2c(O)c(/C=N/[C@@H](Cc3c[nH]c4ccccc34)C(=O)O)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C23H20N4O6/c1-33-15-6-4-5-14(10-15)27-21(29)17(20(28)26-23(27)32)12-25-19(22(30)31)9-13-11-24-18-8-3-2-7-16(13)18/h2-8,10-12,19,24,29H,9H2,1H3,(H,30,31)(H,26,28,32)/b25-12+/t19-/m0/s1 |
| InChIKey | DCZLCHVEBVQFCT-BPDXMKQKSA-N |
| XLogP | 1.84 |
| TPSA | 149.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|