C25H26N4O5 — CID 4639308
1-(2,5-dimethoxyphenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]pyrimidine-2,4-dione (PubChem CID 4639308) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(2,5-dimethoxyphenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4639308 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]pyrimidine-2,4-dione |
| SMILES | CCC(Cc1c[nH]c2ccccc12)/N=C/c1c(O)n(-c2cc(OC)ccc2OC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H26N4O5/c1-4-16(11-15-13-27-20-8-6-5-7-18(15)20)26-14-19-23(30)28-25(32)29(24(19)31)21-12-17(33-2)9-10-22(21)34-3/h5-10,12-14,16,27,31H,4,11H2,1-3H3,(H,28,30,32)/b26-14+ |
| InChIKey | WUBXTDGKTMCNQG-VULFUBBASA-N |
| XLogP | 3.17 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|