C26H34N4O6 — CID 66751470
4-(2-aminoethyl)benzene-1,2-diol;3-(2-aminoethyl)-1H-indol-5-ol;4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol (PubChem CID 66751470) has the molecular formula C26H34N4O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,2-diol;3-(2-aminoethyl)-1H-indol-5-ol;4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol.
| Compound Name | 4-(2-aminoethyl)benzene-1,2-diol;3-(2-aminoethyl)-1H-indol-5-ol;4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 66751470 |
| Molecular Formula | C26H34N4O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;3-(2-aminoethyl)-1H-indol-5-ol;4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol |
| SMILES | NCCc1c[nH]c2ccc(O)cc12.NCCc1ccc(O)c(O)c1.NC[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H12N2O.C8H11NO3.C8H11NO2/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;9-4-8(12)5-1-2-6(10)7(11)3-5;9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5-6,12-13H,3-4,11H2;1-3,8,10-12H,4,9H2;1-2,5,10-11H,3-4,9H2/t;8-;/m.0./s1 |
| InChIKey | LWTCYDUKKGMJJF-JGUUTJLBSA-N |
| XLogP | 2.06 |
| TPSA | 215.23 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|