C22H6BrCl8F7O2 — CID 160613333
5-bromo-1,2,3-trichlorobenzene;1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone;2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethanone (PubChem CID 160613333) has the molecular formula C22H6BrCl8F7O2 and a molecular weight of 798.80 g/mol. Its IUPAC name is 5-bromo-1,2,3-trichlorobenzene;1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone;2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethanone.
| Compound Name | 5-bromo-1,2,3-trichlorobenzene;1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone;2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethanone |
|---|---|
| PubChem CID | 160613333 |
| Molecular Formula | C22H6BrCl8F7O2 |
| Molecular Weight | 798.80 g/mol |
| Exact Mass | 793.69 |
| IUPAC Name | 5-bromo-1,2,3-trichlorobenzene;1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethanone;2,2,2-trifluoro-1-(3,4,5-trichlorophenyl)ethanone |
| SMILES | Clc1cc(Br)cc(Cl)c1Cl.O=C(c1cc(Cl)c(Cl)c(Cl)c1)C(F)(F)F.O=C(c1cc(Cl)c(F)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C8H2Cl3F3O.C8H2Cl2F4O.C6H2BrCl3/c2*9-4-1-3(2-5(10)6(4)11)7(15)8(12,13)14;7-3-1-4(8)6(10)5(9)2-3/h2*1-2H;1-2H |
| InChIKey | RFTLMRSHPXTJIY-UHFFFAOYSA-N |
| XLogP | 12.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.80 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|