C8H2ClF4NO3 — CID 167314125
1-(3-chloro-5-fluoro-4-nitrophenyl)-2,2,2-trifluoroethanone (PubChem CID 167314125) has the molecular formula C8H2ClF4NO3 and a molecular weight of 271.55 g/mol. Its IUPAC name is 1-(3-chloro-5-fluoro-4-nitrophenyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3-chloro-5-fluoro-4-nitrophenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 167314125 |
| Molecular Formula | C8H2ClF4NO3 |
| Molecular Weight | 271.55 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 1-(3-chloro-5-fluoro-4-nitrophenyl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cc(F)c([N+](=O)[O-])c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C8H2ClF4NO3/c9-4-1-3(7(15)8(11,12)13)2-5(10)6(4)14(16)17/h1-2H |
| InChIKey | IOXNJWHIYUDCTJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|