About 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol
4-(3,3,3-trifluoroprop-1-en-2-yl)phenol (PubChem CID 58177606) has the molecular formula C9H7F3O
and a molecular weight of 188.15 g/mol. Its IUPAC name is 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol |
| PubChem CID | 58177606 |
| Molecular Formula | C9H7F3O |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol |
| SMILES | C=C(c1ccc(O)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H7F3O/c1-6(9(10,11)12)7-2-4-8(13)5-3-7/h2-5,13H,1H2 |
| InChIKey | GYTKJBDMIZTIIU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol?
The IUPAC name of 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol (CID 58177606) is 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol.
What is the SMILES notation for 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol?
The canonical SMILES for 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol is C=C(c1ccc(O)cc1)C(F)(F)F.
What is the InChIKey of 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol?
The InChIKey is GYTKJBDMIZTIIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O/c1-6(9(10,11)12)7-2-4-8(13)5-3-7/h2-5,13H,1H2.
What are the key properties of 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol?
4-(3,3,3-trifluoroprop-1-en-2-yl)phenol has a molecular weight of 188.15 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3,3-trifluoroprop-1-en-2-yl)phenol is sourced from PubChem (CID 58177606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).