C10H9F3O — CID 166445243
[4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]methanol (PubChem CID 166445243) has the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. Its IUPAC name is [4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]methanol.
| Compound Name | [4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 166445243 |
| Molecular Formula | C10H9F3O |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | [4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]methanol |
| SMILES | C=C(c1ccc(CO)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O/c1-7(10(11,12)13)9-4-2-8(6-14)3-5-9/h2-5,14H,1,6H2 |
| InChIKey | HDZWPTCZHOUXQY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |