C16H20N2O3 — CID 159984527
4-(aminomethyl)benzoic acid;[4-(aminomethyl)phenyl]methanol (PubChem CID 159984527) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-(aminomethyl)benzoic acid;[4-(aminomethyl)phenyl]methanol.
| Compound Name | 4-(aminomethyl)benzoic acid;[4-(aminomethyl)phenyl]methanol |
|---|---|
| PubChem CID | 159984527 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-(aminomethyl)benzoic acid;[4-(aminomethyl)phenyl]methanol |
| SMILES | NCc1ccc(C(=O)O)cc1.NCc1ccc(CO)cc1 |
| InChI | InChI=1S/C8H9NO2.C8H11NO/c9-5-6-1-3-7(4-2-6)8(10)11;9-5-7-1-3-8(6-10)4-2-7/h1-4H,5,9H2,(H,10,11);1-4,10H,5-6,9H2 |
| InChIKey | OGDXTHJYOCYPHC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |