C18H17NO3 — CID 174343021
4-[(E)-4-[4-(aminomethyl)phenyl]-1-oxobut-2-en-2-yl]benzoic acid (PubChem CID 174343021) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[(E)-4-[4-(aminomethyl)phenyl]-1-oxobut-2-en-2-yl]benzoic acid.
| Compound Name | 4-[(E)-4-[4-(aminomethyl)phenyl]-1-oxobut-2-en-2-yl]benzoic acid |
|---|---|
| PubChem CID | 174343021 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-[(E)-4-[4-(aminomethyl)phenyl]-1-oxobut-2-en-2-yl]benzoic acid |
| SMILES | NCc1ccc(C/C=C(/C=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H17NO3/c19-11-14-3-1-13(2-4-14)5-6-17(12-20)15-7-9-16(10-8-15)18(21)22/h1-4,6-10,12H,5,11,19H2,(H,21,22)/b17-6- |
| InChIKey | KKHLXPXWIHLWMK-FMQZQXMHSA-N |
| XLogP | 2.67 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|