C26H29F3O2 — CID 175233202
4-[(2E)-3,7-dimethylocta-2,6-dienyl]benzoic acid;3,3,3-trifluoroprop-1-en-2-ylbenzene (PubChem CID 175233202) has the molecular formula C26H29F3O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienyl]benzoic acid;3,3,3-trifluoroprop-1-en-2-ylbenzene.
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienyl]benzoic acid;3,3,3-trifluoroprop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 175233202 |
| Molecular Formula | C26H29F3O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienyl]benzoic acid;3,3,3-trifluoroprop-1-en-2-ylbenzene |
| SMILES | C=C(c1ccccc1)C(F)(F)F.CC(C)=CCC/C(C)=C/Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H22O2.C9H7F3/c1-13(2)5-4-6-14(3)7-8-15-9-11-16(12-10-15)17(18)19;1-7(9(10,11)12)8-5-3-2-4-6-8/h5,7,9-12H,4,6,8H2,1-3H3,(H,18,19);2-6H,1H2/b14-7+; |
| InChIKey | JKVFPGYFCPPNRZ-FJUODKGNSA-N |
| XLogP | 7.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|