About CID 57429516
CID 57429516 (PubChem CID 57429516) has the molecular formula C8H7O2
and a molecular weight of 135.14 g/mol.
Molecular Properties
| Compound Name | CID 57429516 |
| PubChem CID | 57429516 |
| Molecular Formula | C8H7O2 |
| Molecular Weight | 135.14 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | — |
| SMILES | C=C([O])c1ccc(O)cc1 |
| InChI | InChI=1S/C8H7O2/c1-6(9)7-2-4-8(10)5-3-7/h2-5,10H,1H2 |
| InChIKey | MXIQNTOOKXCVRK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.14 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze CID 57429516 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57429516?
The IUPAC name of CID 57429516 (CID 57429516) is not available.
What is the SMILES notation for CID 57429516?
The canonical SMILES for CID 57429516 is C=C([O])c1ccc(O)cc1.
What is the InChIKey of CID 57429516?
The InChIKey is MXIQNTOOKXCVRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7O2/c1-6(9)7-2-4-8(10)5-3-7/h2-5,10H,1H2.
What are the key properties of CID 57429516?
CID 57429516 has a molecular weight of 135.14 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57429516 is sourced from PubChem (CID 57429516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).