C26H32O6 — CID 67862171
benzene-1,4-diol;1,4-bis(prop-1-en-2-yl)benzene;bis(2-methylprop-2-enoic acid) (PubChem CID 67862171) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is benzene-1,4-diol;1,4-bis(prop-1-en-2-yl)benzene;bis(2-methylprop-2-enoic acid).
| Compound Name | benzene-1,4-diol;1,4-bis(prop-1-en-2-yl)benzene;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 67862171 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | benzene-1,4-diol;1,4-bis(prop-1-en-2-yl)benzene;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)c1ccc(C(=C)C)cc1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C12H14.C6H6O2.2C4H6O2/c1-9(2)11-5-7-12(8-6-11)10(3)4;7-5-1-2-6(8)4-3-5;2*1-3(2)4(5)6/h5-8H,1,3H2,2,4H3;1-4,7-8H;2*1H2,2H3,(H,5,6) |
| InChIKey | WOFDGYGQIAJRLD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|